Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Benzophenone, 99%, pure
CAS: 119-61-9 Molecular Formula: C13H10O Molecular Weight (g/mol): 182.22 InChI Key: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC Name: diphenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| PubChem CID | 3102 |
|---|---|
| CAS | 119-61-9 |
| Molecular Weight (g/mol) | 182.22 |
| ChEBI | CHEBI:41308 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| IUPAC Name | diphenylmethanone |
| InChI Key | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| Molecular Formula | C13H10O |
Cyclohexene, 99% stab.
CAS: 110-83-8 Molecular Formula: C6H10 Molecular Weight (g/mol): 82.146 MDL Number: MFCD00001539 InChI Key: HGCIXCUEYOPUTN-UHFFFAOYSA-N Synonym: tetrahydrobenzene,cyclohex-1-ene,benzene tetrahydride,1,2,3,4-tetrahydrobenzene,benzenetetrahydride,hexanaphthylene,1-cyclohexene,cykloheksen,benzene, tetrahydro,3,4,5,6-tetrahydrobenzene PubChem CID: 8079 ChEBI: CHEBI:36404 IUPAC Name: cyclohexene SMILES: C1CCC=CC1
| PubChem CID | 8079 |
|---|---|
| CAS | 110-83-8 |
| Molecular Weight (g/mol) | 82.146 |
| ChEBI | CHEBI:36404 |
| MDL Number | MFCD00001539 |
| SMILES | C1CCC=CC1 |
| Synonym | tetrahydrobenzene,cyclohex-1-ene,benzene tetrahydride,1,2,3,4-tetrahydrobenzene,benzenetetrahydride,hexanaphthylene,1-cyclohexene,cykloheksen,benzene, tetrahydro,3,4,5,6-tetrahydrobenzene |
| IUPAC Name | cyclohexene |
| InChI Key | HGCIXCUEYOPUTN-UHFFFAOYSA-N |
| Molecular Formula | C6H10 |
Tartrazine
CAS: 1934-21-0 Molecular Formula: C16H9N4Na3O9S2 Molecular Weight (g/mol): 534.356 MDL Number: MFCD00148908 InChI Key: UJMBCXLDXJUMFB-UHFFFAOYSA-K Synonym: tartrazine,yellow 5,aizen tartrazine,trisodium salt,food yellow 4,tartrazine FD&C yellow #5,c.i. acid yellow 23,atul tartrazine,erio tartrazine,kako tartrazine PubChem CID: 164825 IUPAC Name: trisodium;5-oxo-1-(4-sulfonatophenyl)-4-[(4-sulfonatophenyl)diazenyl]-4H-pyrazole-3-carboxylate SMILES: C1=CC(=CC=C1N=NC2C(=NN(C2=O)C3=CC=C(C=C3)S(=O)(=O)[O-])C(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[Na+]
| PubChem CID | 164825 |
|---|---|
| CAS | 1934-21-0 |
| Molecular Weight (g/mol) | 534.356 |
| MDL Number | MFCD00148908 |
| SMILES | C1=CC(=CC=C1N=NC2C(=NN(C2=O)C3=CC=C(C=C3)S(=O)(=O)[O-])C(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[Na+] |
| Synonym | tartrazine,yellow 5,aizen tartrazine,trisodium salt,food yellow 4,tartrazine FD&C yellow #5,c.i. acid yellow 23,atul tartrazine,erio tartrazine,kako tartrazine |
| IUPAC Name | trisodium;5-oxo-1-(4-sulfonatophenyl)-4-[(4-sulfonatophenyl)diazenyl]-4H-pyrazole-3-carboxylate |
| InChI Key | UJMBCXLDXJUMFB-UHFFFAOYSA-K |
| Molecular Formula | C16H9N4Na3O9S2 |
Choline Chloride, 99%
CAS: 67-48-1 Molecular Formula: C5H14ClNO Molecular Weight (g/mol): 139.62 MDL Number: MFCD00011721 InChI Key: SGMZJAMFUVOLNK-UHFFFAOYSA-M Synonym: choline chloride,hepacholine,biocolina,biocoline,lipotril,paresan,luridin chloride,choline hydrochloride,cholinium chloride,bilineurin chloride PubChem CID: 6209 ChEBI: CHEBI:133341 IUPAC Name: 2-hydroxyethyl(trimethyl)azanium;chloride SMILES: [Cl-].C[N+](C)(C)CCO
| PubChem CID | 6209 |
|---|---|
| CAS | 67-48-1 |
| Molecular Weight (g/mol) | 139.62 |
| ChEBI | CHEBI:133341 |
| MDL Number | MFCD00011721 |
| SMILES | [Cl-].C[N+](C)(C)CCO |
| Synonym | choline chloride,hepacholine,biocolina,biocoline,lipotril,paresan,luridin chloride,choline hydrochloride,cholinium chloride,bilineurin chloride |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;chloride |
| InChI Key | SGMZJAMFUVOLNK-UHFFFAOYSA-M |
| Molecular Formula | C5H14ClNO |
Sodium acetate trihydrate, 99%
CAS: 6131-90-4 Molecular Formula: C2H9NaO5 Molecular Weight (g/mol): 136.079 MDL Number: MFCD00071557 InChI Key: AYRVGWHSXIMRAB-UHFFFAOYSA-M Synonym: sodium acetate trihydrate,thomaegelin,acetic acid, sodium salt, trihydrate,plasmafusin,tutofusin,natrium acetate-3-wasser,unii-4550k0sc9b,sodium acetate usp:jan,sodium acetate usan:jan,sodium acetate tn PubChem CID: 23665404 ChEBI: CHEBI:32138 IUPAC Name: sodium;acetate;trihydrate SMILES: CC(=O)[O-].O.O.O.[Na+]
| PubChem CID | 23665404 |
|---|---|
| CAS | 6131-90-4 |
| Molecular Weight (g/mol) | 136.079 |
| ChEBI | CHEBI:32138 |
| MDL Number | MFCD00071557 |
| SMILES | CC(=O)[O-].O.O.O.[Na+] |
| Synonym | sodium acetate trihydrate,thomaegelin,acetic acid, sodium salt, trihydrate,plasmafusin,tutofusin,natrium acetate-3-wasser,unii-4550k0sc9b,sodium acetate usp:jan,sodium acetate usan:jan,sodium acetate tn |
| IUPAC Name | sodium;acetate;trihydrate |
| InChI Key | AYRVGWHSXIMRAB-UHFFFAOYSA-M |
| Molecular Formula | C2H9NaO5 |
(Trimethylsilyl)diazomethane, 1.8 to 2.4M solution in hexanes
CAS: 18107-18-1 Molecular Formula: C4H10N2Si Molecular Weight (g/mol): 114.22 InChI Key: ONDSBJMLAHVLMI-UHFFFAOYSA-N Synonym: trimethylsilyl diazomethane,trimethylsilyldiazomethane,diazomethyl trimethylsilane,tms-diazomethane,diazomethyl trimethyl silane,tmschn2,silane, diazomethyl trimethyl,unii-qi98hqo8c4,diazomethyl-trimethyl-silane,qi98hqo8c4 PubChem CID: 167693 IUPAC Name: diazomethyl(trimethyl)silane SMILES: C[Si](C)(C)C=[N+]=[N-]
| PubChem CID | 167693 |
|---|---|
| CAS | 18107-18-1 |
| Molecular Weight (g/mol) | 114.22 |
| SMILES | C[Si](C)(C)C=[N+]=[N-] |
| Synonym | trimethylsilyl diazomethane,trimethylsilyldiazomethane,diazomethyl trimethylsilane,tms-diazomethane,diazomethyl trimethyl silane,tmschn2,silane, diazomethyl trimethyl,unii-qi98hqo8c4,diazomethyl-trimethyl-silane,qi98hqo8c4 |
| IUPAC Name | diazomethyl(trimethyl)silane |
| InChI Key | ONDSBJMLAHVLMI-UHFFFAOYSA-N |
| Molecular Formula | C4H10N2Si |
Tetrachloroethylene, 99%, extra pure
CAS: 127-18-4 Molecular Formula: C2Cl4 Molecular Weight (g/mol): 165.82 MDL Number: MFCD00000834 InChI Key: CYTYCFOTNPOANT-UHFFFAOYSA-N Synonym: tetrachloroethylene,tetrachloroethene,perchloroethylene,perchlorethylene,perc,ethene, tetrachloro,tetrachlorethylene,ethylene tetrachloride,carbon dichloride,ankilostin PubChem CID: 31373 ChEBI: CHEBI:17300 IUPAC Name: 1,1,2,2-tetrachloroethene SMILES: ClC(Cl)=C(Cl)Cl
| PubChem CID | 31373 |
|---|---|
| CAS | 127-18-4 |
| Molecular Weight (g/mol) | 165.82 |
| ChEBI | CHEBI:17300 |
| MDL Number | MFCD00000834 |
| SMILES | ClC(Cl)=C(Cl)Cl |
| Synonym | tetrachloroethylene,tetrachloroethene,perchloroethylene,perchlorethylene,perc,ethene, tetrachloro,tetrachlorethylene,ethylene tetrachloride,carbon dichloride,ankilostin |
| IUPAC Name | 1,1,2,2-tetrachloroethene |
| InChI Key | CYTYCFOTNPOANT-UHFFFAOYSA-N |
| Molecular Formula | C2Cl4 |
DL-alpha-Tocopherol, 97+%
CAS: 10191-41-0 Molecular Formula: C29H50O2 Molecular Weight (g/mol): 430.72 MDL Number: MFCD00072051 InChI Key: GVJHHUAWPYXKBD-IEOSBIPESA-N Synonym: vitamin e,alpha-tocopherol,d-alpha-tocopherol,5,7,8-trimethyltocol,+-alpha-tocopherol,r,r,r-alpha-tocopherol,phytogermine,eprolin,2r,4'r,8'r-alpha-tocopherol,dl-a-tocopherol PubChem CID: 14985 ChEBI: CHEBI:18145 IUPAC Name: (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol SMILES: CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCC2=C(C)C(O)=C(C)C(C)=C2O1
| PubChem CID | 14985 |
|---|---|
| CAS | 10191-41-0 |
| Molecular Weight (g/mol) | 430.72 |
| ChEBI | CHEBI:18145 |
| MDL Number | MFCD00072051 |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCC2=C(C)C(O)=C(C)C(C)=C2O1 |
| Synonym | vitamin e,alpha-tocopherol,d-alpha-tocopherol,5,7,8-trimethyltocol,+-alpha-tocopherol,r,r,r-alpha-tocopherol,phytogermine,eprolin,2r,4'r,8'r-alpha-tocopherol,dl-a-tocopherol |
| IUPAC Name | (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol |
| InChI Key | GVJHHUAWPYXKBD-IEOSBIPESA-N |
| Molecular Formula | C29H50O2 |
Naphthalene, 99%
CAS: 91-20-3 Molecular Formula: C10H8 Molecular Weight (g/mol): 128.17 MDL Number: MFCD00001742 InChI Key: UFWIBTONFRDIAS-UHFFFAOYSA-N Synonym: naphthalin,naphthene,camphor tar,tar camphor,white tar,albocarbon,naphthaline,moth flakes,moth balls,naphtalene PubChem CID: 931 ChEBI: CHEBI:16482 IUPAC Name: naphthalene SMILES: C1=CC2=CC=CC=C2C=C1
| PubChem CID | 931 |
|---|---|
| CAS | 91-20-3 |
| Molecular Weight (g/mol) | 128.17 |
| ChEBI | CHEBI:16482 |
| MDL Number | MFCD00001742 |
| SMILES | C1=CC2=CC=CC=C2C=C1 |
| Synonym | naphthalin,naphthene,camphor tar,tar camphor,white tar,albocarbon,naphthaline,moth flakes,moth balls,naphtalene |
| IUPAC Name | naphthalene |
| InChI Key | UFWIBTONFRDIAS-UHFFFAOYSA-N |
| Molecular Formula | C10H8 |
1-Naphthol, 99%
CAS: 90-15-3 Molecular Formula: C10H8O Molecular Weight (g/mol): 144.173 MDL Number: MFCD00003930 InChI Key: KJCVRFUGPWSIIH-UHFFFAOYSA-N Synonym: 1-naphthol,1-naphthalenol,alpha-naphthol,1-hydroxynaphthalene,naphthol,fouramine ern,fourrine ern,tertral ern,furro er,basf ursol ern PubChem CID: 7005 ChEBI: CHEBI:10319 IUPAC Name: naphthalen-1-ol SMILES: C1=CC=C2C(=C1)C=CC=C2O
| PubChem CID | 7005 |
|---|---|
| CAS | 90-15-3 |
| Molecular Weight (g/mol) | 144.173 |
| ChEBI | CHEBI:10319 |
| MDL Number | MFCD00003930 |
| SMILES | C1=CC=C2C(=C1)C=CC=C2O |
| Synonym | 1-naphthol,1-naphthalenol,alpha-naphthol,1-hydroxynaphthalene,naphthol,fouramine ern,fourrine ern,tertral ern,furro er,basf ursol ern |
| IUPAC Name | naphthalen-1-ol |
| InChI Key | KJCVRFUGPWSIIH-UHFFFAOYSA-N |
| Molecular Formula | C10H8O |
2-Naphthol, 99+%
CAS: 135-19-3 Molecular Formula: C10H8O Molecular Weight (g/mol): 144.17 MDL Number: MFCD00004067 InChI Key: JWAZRIHNYRIHIV-UHFFFAOYSA-N Synonym: 2-naphthol,2-naphthalenol,beta-naphthol,2-hydroxynaphthalene,betanaphthol,isonaphthol,developer bn,naphthol b,azogen developer a,beta-napthol PubChem CID: 8663 ChEBI: CHEBI:10432 IUPAC Name: naphthalen-2-ol SMILES: C1=CC=C2C=C(C=CC2=C1)O
| PubChem CID | 8663 |
|---|---|
| CAS | 135-19-3 |
| Molecular Weight (g/mol) | 144.17 |
| ChEBI | CHEBI:10432 |
| MDL Number | MFCD00004067 |
| SMILES | C1=CC=C2C=C(C=CC2=C1)O |
| Synonym | 2-naphthol,2-naphthalenol,beta-naphthol,2-hydroxynaphthalene,betanaphthol,isonaphthol,developer bn,naphthol b,azogen developer a,beta-napthol |
| IUPAC Name | naphthalen-2-ol |
| InChI Key | JWAZRIHNYRIHIV-UHFFFAOYSA-N |
| Molecular Formula | C10H8O |
Sodium 1-pentanesulfonate monohydrate, HPLC grade
CAS: 207605-40-1 Molecular Formula: C5H13NaO4S Molecular Weight (g/mol): 192.205 MDL Number: MFCD00007541 InChI Key: FPQYXAFKHLSWTI-UHFFFAOYSA-M Synonym: sodium pentane-1-sulfonate hydrate,1-pentanesulfonic acid sodium salt monohydrate,sodium 1-pentanesulfonate monohydrate,potassium hydrate pentane-1-sulfonate,sodium 1-pentanesulfonate hydrate,sodium hydrate pentane-1-sulfonate,sodium pentane-1-sulfonate-water 1/1/1,1-pentane sulphonic acid sodium salt monohydrate,1-pentanesulfonic acid sodium salt monohydydrate,sodium 1-pentanesulfonate monohydrate, hplc grade PubChem CID: 23693099 IUPAC Name: sodium;pentane-1-sulfonate;hydrate SMILES: CCCCCS(=O)(=O)[O-].O.[Na+]
| PubChem CID | 23693099 |
|---|---|
| CAS | 207605-40-1 |
| Molecular Weight (g/mol) | 192.205 |
| MDL Number | MFCD00007541 |
| SMILES | CCCCCS(=O)(=O)[O-].O.[Na+] |
| Synonym | sodium pentane-1-sulfonate hydrate,1-pentanesulfonic acid sodium salt monohydrate,sodium 1-pentanesulfonate monohydrate,potassium hydrate pentane-1-sulfonate,sodium 1-pentanesulfonate hydrate,sodium hydrate pentane-1-sulfonate,sodium pentane-1-sulfonate-water 1/1/1,1-pentane sulphonic acid sodium salt monohydrate,1-pentanesulfonic acid sodium salt monohydydrate,sodium 1-pentanesulfonate monohydrate, hplc grade |
| IUPAC Name | sodium;pentane-1-sulfonate;hydrate |
| InChI Key | FPQYXAFKHLSWTI-UHFFFAOYSA-M |
| Molecular Formula | C5H13NaO4S |
Chitosan, 85% deacetylated
CAS: 9012-76-4 Molecular Formula: C56H103N9O39 Molecular Weight (g/mol): 1526.464 MDL Number: MFCD00161512 InChI Key: FLASNYPZGWUPSU-SICDJOISSA-N Synonym: chitosan,poliglusam,deacetylchitin,chicol,flonac c,flonac n,sea cure plus,kytex h,kytex m,kimitsu chitosan f PubChem CID: 71853 IUPAC Name: methyl N-[(2S,3R,4R,5S,6R)-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hy SMILES: COC(=O)NC1C(C(C(OC1OC2C(OC(C(C2O)N)OC3C(OC(C(C3O)N)O)CO)CO)CO)OC4C(C(C(C(O4)CO)OC5C(C(C(C(O5)CO)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)OC9C(C(C(C(O9)CO)O)O)N)O)N)O)N)O)N)O)N)O)N)O
| PubChem CID | 71853 |
|---|---|
| CAS | 9012-76-4 |
| Molecular Weight (g/mol) | 1526.464 |
| MDL Number | MFCD00161512 |
| SMILES | COC(=O)NC1C(C(C(OC1OC2C(OC(C(C2O)N)OC3C(OC(C(C3O)N)O)CO)CO)CO)OC4C(C(C(C(O4)CO)OC5C(C(C(C(O5)CO)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)OC9C(C(C(C(O9)CO)O)O)N)O)N)O)N)O)N)O)N)O)N)O |
| Synonym | chitosan,poliglusam,deacetylchitin,chicol,flonac c,flonac n,sea cure plus,kytex h,kytex m,kimitsu chitosan f |
| IUPAC Name | methyl N-[(2S,3R,4R,5S,6R)-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hy |
| InChI Key | FLASNYPZGWUPSU-SICDJOISSA-N |
| Molecular Formula | C56H103N9O39 |
1,5-Diphenylcarbazide, ACS
CAS: 140-22-7 Molecular Formula: C13H14N4O Molecular Weight (g/mol): 242.282 MDL Number: MFCD00003013 InChI Key: KSPIHGBHKVISFI-UHFFFAOYSA-N Synonym: 1,5-diphenylcarbazide,diphenylcarbazide,1,5-diphenylcarbohydrazide,carbonic dihydrazide, 2,2'-diphenyl,1,5-diphenylcarbonohydrazide,1,5-diphenylcabohydrazide,sym-diphenylcarbazide,n,n'-diphenylcarbazide,2,2'-diphenylcarbazide,carbohydrazide, 1,5-diphenyl PubChem CID: 8789 ChEBI: CHEBI:4641 IUPAC Name: 1,3-dianilinourea SMILES: C1=CC=C(C=C1)NNC(=O)NNC2=CC=CC=C2
| PubChem CID | 8789 |
|---|---|
| CAS | 140-22-7 |
| Molecular Weight (g/mol) | 242.282 |
| ChEBI | CHEBI:4641 |
| MDL Number | MFCD00003013 |
| SMILES | C1=CC=C(C=C1)NNC(=O)NNC2=CC=CC=C2 |
| Synonym | 1,5-diphenylcarbazide,diphenylcarbazide,1,5-diphenylcarbohydrazide,carbonic dihydrazide, 2,2'-diphenyl,1,5-diphenylcarbonohydrazide,1,5-diphenylcabohydrazide,sym-diphenylcarbazide,n,n'-diphenylcarbazide,2,2'-diphenylcarbazide,carbohydrazide, 1,5-diphenyl |
| IUPAC Name | 1,3-dianilinourea |
| InChI Key | KSPIHGBHKVISFI-UHFFFAOYSA-N |
| Molecular Formula | C13H14N4O |
Polyethylene glycol 200
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |